About ethane;2-ethylbutanoic acid
ethane;2-ethylbutanoic acid (PubChem CID 142229949) has the molecular formula C8H18O2
and a molecular weight of 146.23 g/mol. Its IUPAC name is ethane;2-ethylbutanoic acid.
Molecular Properties
| Compound Name | ethane;2-ethylbutanoic acid |
| PubChem CID | 142229949 |
| Molecular Formula | C8H18O2 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.13 |
| IUPAC Name | ethane;2-ethylbutanoic acid |
| SMILES | CC.CCC(CC)C(=O)O |
| InChI | InChI=1S/C6H12O2.C2H6/c1-3-5(4-2)6(7)8;1-2/h5H,3-4H2,1-2H3,(H,7,8);1-2H3 |
| InChIKey | VSHGCBUQFRFRNK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-ethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethylbutanoic acid?
The IUPAC name of ethane;2-ethylbutanoic acid (CID 142229949) is ethane;2-ethylbutanoic acid.
What is the SMILES notation for ethane;2-ethylbutanoic acid?
The canonical SMILES for ethane;2-ethylbutanoic acid is CC.CCC(CC)C(=O)O.
What is the InChIKey of ethane;2-ethylbutanoic acid?
The InChIKey is VSHGCBUQFRFRNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C2H6/c1-3-5(4-2)6(7)8;1-2/h5H,3-4H2,1-2H3,(H,7,8);1-2H3.
What are the key properties of ethane;2-ethylbutanoic acid?
ethane;2-ethylbutanoic acid has a molecular weight of 146.23 g/mol, XLogP of 2.53, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethylbutanoic acid is sourced from PubChem (CID 142229949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).