About 2-ethylbutanoylperoxy 2-ethylbutaneperoxoate
2-ethylbutanoylperoxy 2-ethylbutaneperoxoate (PubChem CID 56625964) has the molecular formula C12H22O6
and a molecular weight of 262.30 g/mol. Its IUPAC name is 2-ethylbutanoylperoxy 2-ethylbutaneperoxoate.
Molecular Properties
| Compound Name | 2-ethylbutanoylperoxy 2-ethylbutaneperoxoate |
| PubChem CID | 56625964 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-ethylbutanoylperoxy 2-ethylbutaneperoxoate |
| SMILES | CCC(CC)C(=O)OOOOC(=O)C(CC)CC |
| InChI | InChI=1S/C12H22O6/c1-5-9(6-2)11(13)15-17-18-16-12(14)10(7-3)8-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | TUOMSSZMYOSHIB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylbutanoylperoxy 2-ethylbutaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylbutanoylperoxy 2-ethylbutaneperoxoate?
The IUPAC name of 2-ethylbutanoylperoxy 2-ethylbutaneperoxoate (CID 56625964) is 2-ethylbutanoylperoxy 2-ethylbutaneperoxoate.
What is the SMILES notation for 2-ethylbutanoylperoxy 2-ethylbutaneperoxoate?
The canonical SMILES for 2-ethylbutanoylperoxy 2-ethylbutaneperoxoate is CCC(CC)C(=O)OOOOC(=O)C(CC)CC.
What is the InChIKey of 2-ethylbutanoylperoxy 2-ethylbutaneperoxoate?
The InChIKey is TUOMSSZMYOSHIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O6/c1-5-9(6-2)11(13)15-17-18-16-12(14)10(7-3)8-4/h9-10H,5-8H2,1-4H3.
What are the key properties of 2-ethylbutanoylperoxy 2-ethylbutaneperoxoate?
2-ethylbutanoylperoxy 2-ethylbutaneperoxoate has a molecular weight of 262.30 g/mol, XLogP of 2.72, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylbutanoylperoxy 2-ethylbutaneperoxoate is sourced from PubChem (CID 56625964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).