About sodium;ethyl 2-ethylbutanoate;hydride
sodium;ethyl 2-ethylbutanoate;hydride (PubChem CID 174848178) has the molecular formula C8H17NaO2
and a molecular weight of 168.21 g/mol. Its IUPAC name is sodium;ethyl 2-ethylbutanoate;hydride.
Molecular Properties
| Compound Name | sodium;ethyl 2-ethylbutanoate;hydride |
| PubChem CID | 174848178 |
| Molecular Formula | C8H17NaO2 |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | sodium;ethyl 2-ethylbutanoate;hydride |
| SMILES | CCOC(=O)C(CC)CC.[H-].[Na+] |
| InChI | InChI=1S/C8H16O2.Na.H/c1-4-7(5-2)8(9)10-6-3;;/h7H,4-6H2,1-3H3;;/q;+1;-1 |
| InChIKey | PQYNMCUDIXGABF-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;ethyl 2-ethylbutanoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;ethyl 2-ethylbutanoate;hydride?
The IUPAC name of sodium;ethyl 2-ethylbutanoate;hydride (CID 174848178) is sodium;ethyl 2-ethylbutanoate;hydride.
What is the SMILES notation for sodium;ethyl 2-ethylbutanoate;hydride?
The canonical SMILES for sodium;ethyl 2-ethylbutanoate;hydride is CCOC(=O)C(CC)CC.[H-].[Na+].
What is the InChIKey of sodium;ethyl 2-ethylbutanoate;hydride?
The InChIKey is PQYNMCUDIXGABF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.Na.H/c1-4-7(5-2)8(9)10-6-3;;/h7H,4-6H2,1-3H3;;/q;+1;-1.
What are the key properties of sodium;ethyl 2-ethylbutanoate;hydride?
sodium;ethyl 2-ethylbutanoate;hydride has a molecular weight of 168.21 g/mol, XLogP of -0.90, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;ethyl 2-ethylbutanoate;hydride is sourced from PubChem (CID 174848178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).