About (ethoxycarbonylamino) 2-ethylbutanoate
(ethoxycarbonylamino) 2-ethylbutanoate (PubChem CID 174978279) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is (ethoxycarbonylamino) 2-ethylbutanoate.
Molecular Properties
| Compound Name | (ethoxycarbonylamino) 2-ethylbutanoate |
| PubChem CID | 174978279 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | (ethoxycarbonylamino) 2-ethylbutanoate |
| SMILES | CCOC(=O)NOC(=O)C(CC)CC |
| InChI | InChI=1S/C9H17NO4/c1-4-7(5-2)8(11)14-10-9(12)13-6-3/h7H,4-6H2,1-3H3,(H,10,12) |
| InChIKey | WVAVKBASGCMJQT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (ethoxycarbonylamino) 2-ethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (ethoxycarbonylamino) 2-ethylbutanoate?
The IUPAC name of (ethoxycarbonylamino) 2-ethylbutanoate (CID 174978279) is (ethoxycarbonylamino) 2-ethylbutanoate.
What is the SMILES notation for (ethoxycarbonylamino) 2-ethylbutanoate?
The canonical SMILES for (ethoxycarbonylamino) 2-ethylbutanoate is CCOC(=O)NOC(=O)C(CC)CC.
What is the InChIKey of (ethoxycarbonylamino) 2-ethylbutanoate?
The InChIKey is WVAVKBASGCMJQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4/c1-4-7(5-2)8(11)14-10-9(12)13-6-3/h7H,4-6H2,1-3H3,(H,10,12).
What are the key properties of (ethoxycarbonylamino) 2-ethylbutanoate?
(ethoxycarbonylamino) 2-ethylbutanoate has a molecular weight of 203.24 g/mol, XLogP of 1.63, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (ethoxycarbonylamino) 2-ethylbutanoate is sourced from PubChem (CID 174978279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).