About cyclobutane;2-(2-ethylbutanoyloxy)ethyl 2-ethylbutanoate
cyclobutane;2-(2-ethylbutanoyloxy)ethyl 2-ethylbutanoate (PubChem CID 67882707) has the molecular formula C18H34O4
and a molecular weight of 314.47 g/mol. Its IUPAC name is cyclobutane;2-(2-ethylbutanoyloxy)ethyl 2-ethylbutanoate.
Molecular Properties
| Compound Name | cyclobutane;2-(2-ethylbutanoyloxy)ethyl 2-ethylbutanoate |
| PubChem CID | 67882707 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | cyclobutane;2-(2-ethylbutanoyloxy)ethyl 2-ethylbutanoate |
| SMILES | C1CCC1.CCC(CC)C(=O)OCCOC(=O)C(CC)CC |
| InChI | InChI=1S/C14H26O4.C4H8/c1-5-11(6-2)13(15)17-9-10-18-14(16)12(7-3)8-4;1-2-4-3-1/h11-12H,5-10H2,1-4H3;1-4H2 |
| InChIKey | IFWJWVUILYZMBT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cyclobutane;2-(2-ethylbutanoyloxy)ethyl 2-ethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutane;2-(2-ethylbutanoyloxy)ethyl 2-ethylbutanoate?
The IUPAC name of cyclobutane;2-(2-ethylbutanoyloxy)ethyl 2-ethylbutanoate (CID 67882707) is cyclobutane;2-(2-ethylbutanoyloxy)ethyl 2-ethylbutanoate.
What is the SMILES notation for cyclobutane;2-(2-ethylbutanoyloxy)ethyl 2-ethylbutanoate?
The canonical SMILES for cyclobutane;2-(2-ethylbutanoyloxy)ethyl 2-ethylbutanoate is C1CCC1.CCC(CC)C(=O)OCCOC(=O)C(CC)CC.
What is the InChIKey of cyclobutane;2-(2-ethylbutanoyloxy)ethyl 2-ethylbutanoate?
The InChIKey is IFWJWVUILYZMBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O4.C4H8/c1-5-11(6-2)13(15)17-9-10-18-14(16)12(7-3)8-4;1-2-4-3-1/h11-12H,5-10H2,1-4H3;1-4H2.
What are the key properties of cyclobutane;2-(2-ethylbutanoyloxy)ethyl 2-ethylbutanoate?
cyclobutane;2-(2-ethylbutanoyloxy)ethyl 2-ethylbutanoate has a molecular weight of 314.47 g/mol, XLogP of 4.51, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutane;2-(2-ethylbutanoyloxy)ethyl 2-ethylbutanoate is sourced from PubChem (CID 67882707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).