About hex-4-en-3-one;methane;pentan-3-one
hex-4-en-3-one;methane;pentan-3-one (PubChem CID 160932179) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is hex-4-en-3-one;methane;pentan-3-one.
Molecular Properties
| Compound Name | hex-4-en-3-one;methane;pentan-3-one |
| PubChem CID | 160932179 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | hex-4-en-3-one;methane;pentan-3-one |
| SMILES | C.CC=CC(=O)CC.CCC(=O)CC |
| InChI | InChI=1S/C6H10O.C5H10O.CH4/c1-3-5-6(7)4-2;1-3-5(6)4-2;/h3,5H,4H2,1-2H3;3-4H2,1-2H3;1H4 |
| InChIKey | STKHYSSXOXEAHE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze hex-4-en-3-one;methane;pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-4-en-3-one;methane;pentan-3-one?
The IUPAC name of hex-4-en-3-one;methane;pentan-3-one (CID 160932179) is hex-4-en-3-one;methane;pentan-3-one.
What is the SMILES notation for hex-4-en-3-one;methane;pentan-3-one?
The canonical SMILES for hex-4-en-3-one;methane;pentan-3-one is C.CC=CC(=O)CC.CCC(=O)CC.
What is the InChIKey of hex-4-en-3-one;methane;pentan-3-one?
The InChIKey is STKHYSSXOXEAHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O.C5H10O.CH4/c1-3-5-6(7)4-2;1-3-5(6)4-2;/h3,5H,4H2,1-2H3;3-4H2,1-2H3;1H4.
What are the key properties of hex-4-en-3-one;methane;pentan-3-one?
hex-4-en-3-one;methane;pentan-3-one has a molecular weight of 200.32 g/mol, XLogP of 3.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hex-4-en-3-one;methane;pentan-3-one is sourced from PubChem (CID 160932179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).