C7H9ClO — CID 58952072
(2E,4E)-3-methylhexa-2,4-dienoyl chloride (PubChem CID 58952072) has the molecular formula C7H9ClO and a molecular weight of 144.60 g/mol. Its IUPAC name is (2E,4E)-3-methylhexa-2,4-dienoyl chloride.
| Compound Name | (2E,4E)-3-methylhexa-2,4-dienoyl chloride |
|---|---|
| PubChem CID | 58952072 |
| Molecular Formula | C7H9ClO |
| Molecular Weight | 144.60 g/mol |
| Exact Mass | 144.03 |
| IUPAC Name | (2E,4E)-3-methylhexa-2,4-dienoyl chloride |
| SMILES | C/C=C/C(C)=C/C(=O)Cl |
| InChI | InChI=1S/C7H9ClO/c1-3-4-6(2)5-7(8)9/h3-5H,1-2H3/b4-3+,6-5+ |
| InChIKey | AMUAAMAKGLXTCS-VNKDHWASSA-N |
| XLogP | 2.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.60 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|