About but-2-enoyl chloride;2-methylprop-2-enamide
but-2-enoyl chloride;2-methylprop-2-enamide (PubChem CID 174791232) has the molecular formula C8H12ClNO2
and a molecular weight of 189.64 g/mol. Its IUPAC name is but-2-enoyl chloride;2-methylprop-2-enamide.
Molecular Properties
| Compound Name | but-2-enoyl chloride;2-methylprop-2-enamide |
| PubChem CID | 174791232 |
| Molecular Formula | C8H12ClNO2 |
| Molecular Weight | 189.64 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | but-2-enoyl chloride;2-methylprop-2-enamide |
| SMILES | C=C(C)C(N)=O.CC=CC(=O)Cl |
| InChI | InChI=1S/C4H5ClO.C4H7NO/c1-2-3-4(5)6;1-3(2)4(5)6/h2-3H,1H3;1H2,2H3,(H2,5,6) |
| InChIKey | QPWWELCGBDTZBC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.64 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enoyl chloride;2-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enoyl chloride;2-methylprop-2-enamide?
The IUPAC name of but-2-enoyl chloride;2-methylprop-2-enamide (CID 174791232) is but-2-enoyl chloride;2-methylprop-2-enamide.
What is the SMILES notation for but-2-enoyl chloride;2-methylprop-2-enamide?
The canonical SMILES for but-2-enoyl chloride;2-methylprop-2-enamide is C=C(C)C(N)=O.CC=CC(=O)Cl.
What is the InChIKey of but-2-enoyl chloride;2-methylprop-2-enamide?
The InChIKey is QPWWELCGBDTZBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClO.C4H7NO/c1-2-3-4(5)6;1-3(2)4(5)6/h2-3H,1H3;1H2,2H3,(H2,5,6).
What are the key properties of but-2-enoyl chloride;2-methylprop-2-enamide?
but-2-enoyl chloride;2-methylprop-2-enamide has a molecular weight of 189.64 g/mol, XLogP of 1.38, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enoyl chloride;2-methylprop-2-enamide is sourced from PubChem (CID 174791232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).