C10H16 — CID 124560377
(4E,6Z)-2,5-dimethylocta-2,4,6-triene (PubChem CID 124560377) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is (4E,6Z)-2,5-dimethylocta-2,4,6-triene.
| Compound Name | (4E,6Z)-2,5-dimethylocta-2,4,6-triene |
|---|---|
| PubChem CID | 124560377 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | (4E,6Z)-2,5-dimethylocta-2,4,6-triene |
| SMILES | C/C=C\C(C)=C\C=C(C)C |
| InChI | InChI=1S/C10H16/c1-5-6-10(4)8-7-9(2)3/h5-8H,1-4H3/b6-5-,10-8+ |
| InChIKey | VMJZCRLJWCETEG-UGXDAERVSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|