C23H30O — CID 10496105
(3E,5E,7E,9E,11E,13Z,15E,17E)-3,7,12,16-tetramethylnonadeca-3,5,7,9,11,13,15,17-octaen-2-one (PubChem CID 10496105) has the molecular formula C23H30O and a molecular weight of 322.49 g/mol. Its IUPAC name is (3E,5E,7E,9E,11E,13Z,15E,17E)-3,7,12,16-tetramethylnonadeca-3,5,7,9,11,13,15,17-octaen-2-one.
| Compound Name | (3E,5E,7E,9E,11E,13Z,15E,17E)-3,7,12,16-tetramethylnonadeca-3,5,7,9,11,13,15,17-octaen-2-one |
|---|---|
| PubChem CID | 10496105 |
| Molecular Formula | C23H30O |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (3E,5E,7E,9E,11E,13Z,15E,17E)-3,7,12,16-tetramethylnonadeca-3,5,7,9,11,13,15,17-octaen-2-one |
| SMILES | C/C=C/C(C)=C/C=C\C(C)=C\C=C\C=C(C)\C=C\C=C(/C)C(C)=O |
| InChI | InChI=1S/C23H30O/c1-7-12-19(2)15-10-16-20(3)13-8-9-14-21(4)17-11-18-22(5)23(6)24/h7-18H,1-6H3/b9-8+,12-7+,16-10-,17-11+,19-15+,20-13+,21-14+,22-18+ |
| InChIKey | WJBBBZJQKDJDPJ-OQGMQICKSA-N |
| XLogP | 6.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|