C20H24NaO4+ — CID 138319468
sodium (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-tetramethylhexadeca-2,4,6,8,10,12,14-heptaenedioic acid (PubChem CID 138319468) has the molecular formula C20H24NaO4+ and a molecular weight of 351.40 g/mol. Its IUPAC name is sodium (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-tetramethylhexadeca-2,4,6,8,10,12,14-heptaenedioic acid.
| Compound Name | sodium (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-tetramethylhexadeca-2,4,6,8,10,12,14-heptaenedioic acid |
|---|---|
| PubChem CID | 138319468 |
| Molecular Formula | C20H24NaO4+ |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | sodium (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-tetramethylhexadeca-2,4,6,8,10,12,14-heptaenedioic acid |
| SMILES | CC(/C=C/C=C(\C)C(=O)O)=C\C=C\C=C(C)\C=C\C=C(/C)C(=O)O.[Na+] |
| InChI | InChI=1S/C20H24O4.Na/c1-15(11-7-13-17(3)19(21)22)9-5-6-10-16(2)12-8-14-18(4)20(23)24;/h5-14H,1-4H3,(H,21,22)(H,23,24);/q;+1/b6-5+,11-7+,12-8+,15-9+,16-10+,17-13+,18-14+; |
| InChIKey | CQQNQCQLTMNXQL-DWBLJZBXSA-N |
| XLogP | 1.61 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|