C25H30O5 — CID 102176053
(2E,4E,6E,8E,10E,12E)-2,7,11-trimethyl-13-(2,4,6-trimethoxyphenyl)trideca-2,4,6,8,10,12-hexaenoic acid (PubChem CID 102176053) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12E)-2,7,11-trimethyl-13-(2,4,6-trimethoxyphenyl)trideca-2,4,6,8,10,12-hexaenoic acid.
| Compound Name | (2E,4E,6E,8E,10E,12E)-2,7,11-trimethyl-13-(2,4,6-trimethoxyphenyl)trideca-2,4,6,8,10,12-hexaenoic acid |
|---|---|
| PubChem CID | 102176053 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (2E,4E,6E,8E,10E,12E)-2,7,11-trimethyl-13-(2,4,6-trimethoxyphenyl)trideca-2,4,6,8,10,12-hexaenoic acid |
| SMILES | COc1cc(OC)c(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(\C)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C25H30O5/c1-18(10-7-8-13-20(3)25(26)27)11-9-12-19(2)14-15-22-23(29-5)16-21(28-4)17-24(22)30-6/h7-17H,1-6H3,(H,26,27)/b8-7+,11-9+,15-14+,18-10+,19-12+,20-13+ |
| InChIKey | HEJFQGAOOULNMW-UFXOQEBTSA-N |
| XLogP | 5.76 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|