C24H28O8S — CID 69485084
4-(2,4,6-trimethoxyphenyl)-1-[(Z)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylbut-3-en-2-one (PubChem CID 69485084) has the molecular formula C24H28O8S and a molecular weight of 476.55 g/mol. Its IUPAC name is 4-(2,4,6-trimethoxyphenyl)-1-[(Z)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylbut-3-en-2-one.
| Compound Name | 4-(2,4,6-trimethoxyphenyl)-1-[(Z)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylbut-3-en-2-one |
|---|---|
| PubChem CID | 69485084 |
| Molecular Formula | C24H28O8S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 4-(2,4,6-trimethoxyphenyl)-1-[(Z)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylbut-3-en-2-one |
| SMILES | COc1cc(OC)c(C=CC(=O)CS(=O)/C=C\c2c(OC)cc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C24H28O8S/c1-27-17-11-21(29-3)19(22(12-17)30-4)8-7-16(25)15-33(26)10-9-20-23(31-5)13-18(28-2)14-24(20)32-6/h7-14H,15H2,1-6H3/b8-7?,10-9- |
| InChIKey | XUQGCGSSLZDXKL-ZFBHTWEGSA-N |
| XLogP | 3.74 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|