C15H18O4 — CID 51040851
(2E,4E)-3-methyl-5-(2,4,6-trimethoxyphenyl)penta-2,4-dienal (PubChem CID 51040851) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is (2E,4E)-3-methyl-5-(2,4,6-trimethoxyphenyl)penta-2,4-dienal.
| Compound Name | (2E,4E)-3-methyl-5-(2,4,6-trimethoxyphenyl)penta-2,4-dienal |
|---|---|
| PubChem CID | 51040851 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (2E,4E)-3-methyl-5-(2,4,6-trimethoxyphenyl)penta-2,4-dienal |
| SMILES | COc1cc(OC)c(/C=C/C(C)=C/C=O)c(OC)c1 |
| InChI | InChI=1S/C15H18O4/c1-11(7-8-16)5-6-13-14(18-3)9-12(17-2)10-15(13)19-4/h5-10H,1-4H3/b6-5+,11-7+ |
| InChIKey | NQBHISDRFQJADZ-LCAICKDSSA-N |
| XLogP | 2.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|