C23H27NO8S — CID 11554730
(E)-3-(2,4,6-trimethoxyphenyl)-N-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylprop-2-enamide (PubChem CID 11554730) has the molecular formula C23H27NO8S and a molecular weight of 477.54 g/mol. Its IUPAC name is (E)-3-(2,4,6-trimethoxyphenyl)-N-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylprop-2-enamide.
| Compound Name | (E)-3-(2,4,6-trimethoxyphenyl)-N-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylprop-2-enamide |
|---|---|
| PubChem CID | 11554730 |
| Molecular Formula | C23H27NO8S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | (E)-3-(2,4,6-trimethoxyphenyl)-N-[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfinylprop-2-enamide |
| SMILES | COc1cc(OC)c(/C=C/C(=O)NS(=O)/C=C/c2c(OC)cc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C23H27NO8S/c1-27-15-11-19(29-3)17(20(12-15)30-4)7-8-23(25)24-33(26)10-9-18-21(31-5)13-16(28-2)14-22(18)32-6/h7-14H,1-6H3,(H,24,25)/b8-7+,10-9+ |
| InChIKey | WWODLFBONNCQMW-XBLVEGMJSA-N |
| XLogP | 3.20 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|