C18H22O3 — CID 54388064
7-(4-methoxy-2,3,6-trimethylphenyl)-5-methylhepta-2,4,6-trienoic acid (PubChem CID 54388064) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is 7-(4-methoxy-2,3,6-trimethylphenyl)-5-methylhepta-2,4,6-trienoic acid.
| Compound Name | 7-(4-methoxy-2,3,6-trimethylphenyl)-5-methylhepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 54388064 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 7-(4-methoxy-2,3,6-trimethylphenyl)-5-methylhepta-2,4,6-trienoic acid |
| SMILES | COc1cc(C)c(C=CC(C)=CC=CC(=O)O)c(C)c1C |
| InChI | InChI=1S/C18H22O3/c1-12(7-6-8-18(19)20)9-10-16-13(2)11-17(21-5)15(4)14(16)3/h6-11H,1-5H3,(H,19,20) |
| InChIKey | VERJUDYRBQPERD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|