C27H39NO3 — CID 173444053
3-aminohexan-3-yl 9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate (PubChem CID 173444053) has the molecular formula C27H39NO3 and a molecular weight of 425.61 g/mol. Its IUPAC name is 3-aminohexan-3-yl 9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate.
| Compound Name | 3-aminohexan-3-yl 9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 173444053 |
| Molecular Formula | C27H39NO3 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | 3-aminohexan-3-yl 9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
| SMILES | CCCC(N)(CC)OC(=O)C=C(C)C=CC=C(C)C=Cc1c(C)cc(OC)c(C)c1C |
| InChI | InChI=1S/C27H39NO3/c1-9-16-27(28,10-2)31-26(29)17-20(4)13-11-12-19(3)14-15-24-21(5)18-25(30-8)23(7)22(24)6/h11-15,17-18H,9-10,16,28H2,1-8H3 |
| InChIKey | XOHCMSKWWZUSPR-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|