C22H27ClO3 — CID 54306850
ethyl 9-(6-chloro-4-methoxy-2,3-dimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate (PubChem CID 54306850) has the molecular formula C22H27ClO3 and a molecular weight of 374.91 g/mol. Its IUPAC name is ethyl 9-(6-chloro-4-methoxy-2,3-dimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate.
| Compound Name | ethyl 9-(6-chloro-4-methoxy-2,3-dimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 54306850 |
| Molecular Formula | C22H27ClO3 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | ethyl 9-(6-chloro-4-methoxy-2,3-dimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
| SMILES | CCOC(=O)C=C(C)C=CC=C(C)C=Cc1c(Cl)cc(OC)c(C)c1C |
| InChI | InChI=1S/C22H27ClO3/c1-7-26-22(24)13-16(3)10-8-9-15(2)11-12-19-17(4)18(5)21(25-6)14-20(19)23/h8-14H,7H2,1-6H3 |
| InChIKey | SIDFZYPSANCZHR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|