C20H21Cl3O3 — CID 6507142
ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,3,6-trichloro-4-methoxyphenyl)nona-2,4,6,8-tetraenoate (PubChem CID 6507142) has the molecular formula C20H21Cl3O3 and a molecular weight of 415.74 g/mol. Its IUPAC name is ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,3,6-trichloro-4-methoxyphenyl)nona-2,4,6,8-tetraenoate.
| Compound Name | ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,3,6-trichloro-4-methoxyphenyl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 6507142 |
| Molecular Formula | C20H21Cl3O3 |
| Molecular Weight | 415.74 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,3,6-trichloro-4-methoxyphenyl)nona-2,4,6,8-tetraenoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/C=C(C)/C=C/c1c(Cl)cc(OC)c(Cl)c1Cl |
| InChI | InChI=1S/C20H21Cl3O3/c1-5-26-18(24)11-14(3)8-6-7-13(2)9-10-15-16(21)12-17(25-4)20(23)19(15)22/h6-12H,5H2,1-4H3/b8-6+,10-9+,13-7+,14-11+ |
| InChIKey | WLZGIVUPQBDVDU-OFCLTBKTSA-N |
| XLogP | 6.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.74 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|