C24H32O3 — CID 154445515
3,7-dimethyl-9-(2,3,6-triethyl-4-methoxyphenyl)nona-2,4,6,8-tetraenoic acid (PubChem CID 154445515) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is 3,7-dimethyl-9-(2,3,6-triethyl-4-methoxyphenyl)nona-2,4,6,8-tetraenoic acid.
| Compound Name | 3,7-dimethyl-9-(2,3,6-triethyl-4-methoxyphenyl)nona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 154445515 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 3,7-dimethyl-9-(2,3,6-triethyl-4-methoxyphenyl)nona-2,4,6,8-tetraenoic acid |
| SMILES | CCc1cc(OC)c(CC)c(CC)c1C=CC(C)=CC=CC(C)=CC(=O)O |
| InChI | InChI=1S/C24H32O3/c1-7-19-16-23(27-6)21(9-3)20(8-2)22(19)14-13-17(4)11-10-12-18(5)15-24(25)26/h10-16H,7-9H2,1-6H3,(H,25,26) |
| InChIKey | XASOQJLNPRYOIV-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|