C20H24O2 — CID 54291992
3,7-dimethyl-9-(2,3,6-trimethylphenyl)nona-2,4,6,8-tetraenoic acid (PubChem CID 54291992) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 3,7-dimethyl-9-(2,3,6-trimethylphenyl)nona-2,4,6,8-tetraenoic acid.
| Compound Name | 3,7-dimethyl-9-(2,3,6-trimethylphenyl)nona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 54291992 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 3,7-dimethyl-9-(2,3,6-trimethylphenyl)nona-2,4,6,8-tetraenoic acid |
| SMILES | CC(C=Cc1c(C)ccc(C)c1C)=CC=CC(C)=CC(=O)O |
| InChI | InChI=1S/C20H24O2/c1-14(7-6-8-15(2)13-20(21)22)9-12-19-17(4)11-10-16(3)18(19)5/h6-13H,1-5H3,(H,21,22) |
| InChIKey | RYDQCTYUWLVEHM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|