C19H24O2 — CID 102164793
(2E,4E,6Z,8E)-9-[(1R,4R,5R)-1,4-dimethyl-3-bicyclo[3.1.0]hex-2-enyl]-3,7-dimethylnona-2,4,6,8-tetraenoic acid (PubChem CID 102164793) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2E,4E,6Z,8E)-9-[(1R,4R,5R)-1,4-dimethyl-3-bicyclo[3.1.0]hex-2-enyl]-3,7-dimethylnona-2,4,6,8-tetraenoic acid.
| Compound Name | (2E,4E,6Z,8E)-9-[(1R,4R,5R)-1,4-dimethyl-3-bicyclo[3.1.0]hex-2-enyl]-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 102164793 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (2E,4E,6Z,8E)-9-[(1R,4R,5R)-1,4-dimethyl-3-bicyclo[3.1.0]hex-2-enyl]-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
| SMILES | CC(=C/C=C/C(C)=C/C(=O)O)/C=C/C1=C[C@]2(C)C[C@@H]2[C@H]1C |
| InChI | InChI=1S/C19H24O2/c1-13(6-5-7-14(2)10-18(20)21)8-9-16-11-19(4)12-17(19)15(16)3/h5-11,15,17H,12H2,1-4H3,(H,20,21)/b7-5+,9-8+,13-6-,14-10+/t15-,17+,19+/m0/s1 |
| InChIKey | WBQZNCZJALIDSG-DHVCJQAHSA-N |
| XLogP | 4.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|