C21H32NO2+ — CID 161084269
[(1R)-2-[(1E,3E,5E,7E)-8-carboxy-3,7-dimethylocta-1,3,5,7-tetraenyl]-1,3-dimethylcyclohex-2-en-1-yl]-dimethylazanium (PubChem CID 161084269) has the molecular formula C21H32NO2+ and a molecular weight of 330.49 g/mol. Its IUPAC name is [(1R)-2-[(1E,3E,5E,7E)-8-carboxy-3,7-dimethylocta-1,3,5,7-tetraenyl]-1,3-dimethylcyclohex-2-en-1-yl]-dimethylazanium.
| Compound Name | [(1R)-2-[(1E,3E,5E,7E)-8-carboxy-3,7-dimethylocta-1,3,5,7-tetraenyl]-1,3-dimethylcyclohex-2-en-1-yl]-dimethylazanium |
|---|---|
| PubChem CID | 161084269 |
| Molecular Formula | C21H32NO2+ |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | [(1R)-2-[(1E,3E,5E,7E)-8-carboxy-3,7-dimethylocta-1,3,5,7-tetraenyl]-1,3-dimethylcyclohex-2-en-1-yl]-dimethylazanium |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)O)[C@](C)([NH+](C)C)CCC1 |
| InChI | InChI=1S/C21H31NO2/c1-16(9-7-10-17(2)15-20(23)24)12-13-19-18(3)11-8-14-21(19,4)22(5)6/h7,9-10,12-13,15H,8,11,14H2,1-6H3,(H,23,24)/p+1/b10-7+,13-12+,16-9+,17-15+/t21-/m1/s1 |
| InChIKey | UGHMPMYLXKRGSU-JLHYCJFUSA-O |
| XLogP | 3.48 |
| TPSA | 41.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|