C20H29NO4S — CID 122535803
(2E,4E,6E,8E)-9-[(6S)-2,6-dimethyl-6-(methylsulfamoyl)cyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenoic acid (PubChem CID 122535803) has the molecular formula C20H29NO4S and a molecular weight of 379.52 g/mol. Its IUPAC name is (2E,4E,6E,8E)-9-[(6S)-2,6-dimethyl-6-(methylsulfamoyl)cyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenoic acid.
| Compound Name | (2E,4E,6E,8E)-9-[(6S)-2,6-dimethyl-6-(methylsulfamoyl)cyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 122535803 |
| Molecular Formula | C20H29NO4S |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | (2E,4E,6E,8E)-9-[(6S)-2,6-dimethyl-6-(methylsulfamoyl)cyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
| SMILES | CNS(=O)(=O)[C@@]1(C)CCCC(C)=C1/C=C/C(C)=C/C=C/C(C)=C/C(=O)O |
| InChI | InChI=1S/C20H29NO4S/c1-15(8-6-9-16(2)14-19(22)23)11-12-18-17(3)10-7-13-20(18,4)26(24,25)21-5/h6,8-9,11-12,14,21H,7,10,13H2,1-5H3,(H,22,23)/b9-6+,12-11+,15-8+,16-14+/t20-/m0/s1 |
| InChIKey | OJVCVHXWIPCLCW-DVKAWBDNSA-N |
| XLogP | 3.88 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|