C26H34O2 — CID 11406304
(2E,4E,6Z,8E)-9-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid (PubChem CID 11406304) has the molecular formula C26H34O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is (2E,4E,6Z,8E)-9-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid.
| Compound Name | (2E,4E,6Z,8E)-9-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 11406304 |
| Molecular Formula | C26H34O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | (2E,4E,6Z,8E)-9-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
| SMILES | CC(=C/C=C/C(C)=C/C(=O)O)/C=C/c1cc(C(C)(C)C)cc2c1CCC2(C)C |
| InChI | InChI=1S/C26H34O2/c1-18(9-8-10-19(2)15-24(27)28)11-12-20-16-21(25(3,4)5)17-23-22(20)13-14-26(23,6)7/h8-12,15-17H,13-14H2,1-7H3,(H,27,28)/b10-8+,12-11+,18-9-,19-15+ |
| InChIKey | XOASAPCPGRYKOL-JJYLAMBOSA-N |
| XLogP | 6.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|