C34H44O3 — CID 173246585
(4E,6Z)-7-[3-[(4-tert-butylphenyl)methoxy]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-methylocta-2,4,6-trienoic acid (PubChem CID 173246585) has the molecular formula C34H44O3 and a molecular weight of 500.72 g/mol. Its IUPAC name is (4E,6Z)-7-[3-[(4-tert-butylphenyl)methoxy]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-methylocta-2,4,6-trienoic acid.
| Compound Name | (4E,6Z)-7-[3-[(4-tert-butylphenyl)methoxy]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-methylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 173246585 |
| Molecular Formula | C34H44O3 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | (4E,6Z)-7-[3-[(4-tert-butylphenyl)methoxy]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-methylocta-2,4,6-trienoic acid |
| SMILES | CC(=CC(=O)O)/C=C/C=C(/C)c1cc2c(cc1OCc1ccc(C(C)(C)C)cc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C34H44O3/c1-23(19-31(35)36)11-10-12-24(2)27-20-28-29(34(8,9)18-17-33(28,6)7)21-30(27)37-22-25-13-15-26(16-14-25)32(3,4)5/h10-16,19-21H,17-18,22H2,1-9H3,(H,35,36)/b11-10+,23-19?,24-12- |
| InChIKey | OSSUOQNIBSCSOK-IXIQVXPYSA-N |
| XLogP | 8.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|