C28H40N2O4 — CID 90957097
8-(1-aminoethoxyimino)-3-methyl-7-(5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)octa-2,4,6-trienoic acid (PubChem CID 90957097) has the molecular formula C28H40N2O4 and a molecular weight of 468.64 g/mol. Its IUPAC name is 8-(1-aminoethoxyimino)-3-methyl-7-(5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)octa-2,4,6-trienoic acid.
| Compound Name | 8-(1-aminoethoxyimino)-3-methyl-7-(5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)octa-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 90957097 |
| Molecular Formula | C28H40N2O4 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | 8-(1-aminoethoxyimino)-3-methyl-7-(5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)octa-2,4,6-trienoic acid |
| SMILES | CCCOc1cc2c(cc1C(C=NOC(C)N)=CC=CC(C)=CC(=O)O)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C28H40N2O4/c1-8-14-33-25-17-24-23(27(4,5)12-13-28(24,6)7)16-22(25)21(18-30-34-20(3)29)11-9-10-19(2)15-26(31)32/h9-11,15-18,20H,8,12-14,29H2,1-7H3,(H,31,32) |
| InChIKey | KZGSZYMBFQPJIA-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|