C28H40O4 — CID 86754092
(2E,4E,6Z)-7-[3-(5-hydroxypentoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-methylocta-2,4,6-trienoic acid (PubChem CID 86754092) has the molecular formula C28H40O4 and a molecular weight of 440.62 g/mol. Its IUPAC name is (2E,4E,6Z)-7-[3-(5-hydroxypentoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-methylocta-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6Z)-7-[3-(5-hydroxypentoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-methylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 86754092 |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | (2E,4E,6Z)-7-[3-(5-hydroxypentoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-methylocta-2,4,6-trienoic acid |
| SMILES | C/C(=C/C=C/C(C)=C/C(=O)O)c1cc2c(cc1OCCCCCO)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C28H40O4/c1-20(17-26(30)31)11-10-12-21(2)22-18-23-24(28(5,6)14-13-27(23,3)4)19-25(22)32-16-9-7-8-15-29/h10-12,17-19,29H,7-9,13-16H2,1-6H3,(H,30,31)/b11-10+,20-17+,21-12- |
| InChIKey | GJWJBXMTBMFERZ-RZLPOJDTSA-N |
| XLogP | 6.57 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|