C31H38O3 — CID 57315797
3-methyl-7-[5,5,8,8-tetramethyl-3-[(4-methylphenyl)methoxy]-6,7-dihydronaphthalen-2-yl]octa-2,4,6-trienoic acid (PubChem CID 57315797) has the molecular formula C31H38O3 and a molecular weight of 458.64 g/mol. Its IUPAC name is 3-methyl-7-[5,5,8,8-tetramethyl-3-[(4-methylphenyl)methoxy]-6,7-dihydronaphthalen-2-yl]octa-2,4,6-trienoic acid.
| Compound Name | 3-methyl-7-[5,5,8,8-tetramethyl-3-[(4-methylphenyl)methoxy]-6,7-dihydronaphthalen-2-yl]octa-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 57315797 |
| Molecular Formula | C31H38O3 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 3-methyl-7-[5,5,8,8-tetramethyl-3-[(4-methylphenyl)methoxy]-6,7-dihydronaphthalen-2-yl]octa-2,4,6-trienoic acid |
| SMILES | CC(C=CC=C(C)c1cc2c(cc1OCc1ccc(C)cc1)C(C)(C)CCC2(C)C)=CC(=O)O |
| InChI | InChI=1S/C31H38O3/c1-21-11-13-24(14-12-21)20-34-28-19-27-26(30(4,5)15-16-31(27,6)7)18-25(28)23(3)10-8-9-22(2)17-29(32)33/h8-14,17-19H,15-16,20H2,1-7H3,(H,32,33) |
| InChIKey | SZHBUDUWNLJSRI-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|