C21H26I2O5S — CID 54498353
(2E,4E,6E)-7-(7-methoxy-4,4-dimethyl-1,1-dioxo-2,3-dihydrothiochromen-6-yl)-3-methylocta-2,4,6-trienoic acid;molecular iodine (PubChem CID 54498353) has the molecular formula C21H26I2O5S and a molecular weight of 644.31 g/mol. Its IUPAC name is (2E,4E,6E)-7-(7-methoxy-4,4-dimethyl-1,1-dioxo-2,3-dihydrothiochromen-6-yl)-3-methylocta-2,4,6-trienoic acid;molecular iodine.
| Compound Name | (2E,4E,6E)-7-(7-methoxy-4,4-dimethyl-1,1-dioxo-2,3-dihydrothiochromen-6-yl)-3-methylocta-2,4,6-trienoic acid;molecular iodine |
|---|---|
| PubChem CID | 54498353 |
| Molecular Formula | C21H26I2O5S |
| Molecular Weight | 644.31 g/mol |
| Exact Mass | 643.96 |
| IUPAC Name | (2E,4E,6E)-7-(7-methoxy-4,4-dimethyl-1,1-dioxo-2,3-dihydrothiochromen-6-yl)-3-methylocta-2,4,6-trienoic acid;molecular iodine |
| SMILES | COc1cc2c(cc1/C(C)=C/C=C/C(C)=C/C(=O)O)C(C)(C)CCS2(=O)=O.II |
| InChI | InChI=1S/C21H26O5S.I2/c1-14(11-20(22)23)7-6-8-15(2)16-12-17-19(13-18(16)26-5)27(24,25)10-9-21(17,3)4;1-2/h6-8,11-13H,9-10H2,1-5H3,(H,22,23);/b7-6+,14-11+,15-8+; |
| InChIKey | YARUVOWVFBPSEG-WHZMGDAZSA-N |
| XLogP | 5.91 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.31 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|