C19H26O2 — CID 10565161
(Z)-3-(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)but-2-enal (PubChem CID 10565161) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is (Z)-3-(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)but-2-enal.
| Compound Name | (Z)-3-(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)but-2-enal |
|---|---|
| PubChem CID | 10565161 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (Z)-3-(3-methoxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)but-2-enal |
| SMILES | COc1cc2c(cc1/C(C)=C\C=O)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C19H26O2/c1-13(7-10-20)14-11-15-16(12-17(14)21-6)19(4,5)9-8-18(15,2)3/h7,10-12H,8-9H2,1-6H3/b13-7- |
| InChIKey | PYQKCMDIMBFIKY-QPEQYQDCSA-N |
| XLogP | 4.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|