C26H38O3 — CID 142517714
(2E,4E,6Z)-7-(4,5-ditert-butyl-2-propoxyphenyl)-3-methylocta-2,4,6-trienoic acid (PubChem CID 142517714) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is (2E,4E,6Z)-7-(4,5-ditert-butyl-2-propoxyphenyl)-3-methylocta-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6Z)-7-(4,5-ditert-butyl-2-propoxyphenyl)-3-methylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 142517714 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | (2E,4E,6Z)-7-(4,5-ditert-butyl-2-propoxyphenyl)-3-methylocta-2,4,6-trienoic acid |
| SMILES | CCCOc1cc(C(C)(C)C)c(C(C)(C)C)cc1/C(C)=C\C=C\C(C)=C\C(=O)O |
| InChI | InChI=1S/C26H38O3/c1-10-14-29-23-17-22(26(7,8)9)21(25(4,5)6)16-20(23)19(3)13-11-12-18(2)15-24(27)28/h11-13,15-17H,10,14H2,1-9H3,(H,27,28)/b12-11+,18-15+,19-13- |
| InChIKey | OPDBCFREGMKNRV-ANPOFYETSA-N |
| XLogP | 7.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|