C24H32F2O3 — CID 59076822
(2E,4E,6Z)-7-[3-tert-butyl-2-(2,2-difluoroethoxy)-5-propan-2-ylphenyl]-3-methylocta-2,4,6-trienoic acid (PubChem CID 59076822) has the molecular formula C24H32F2O3 and a molecular weight of 406.51 g/mol. Its IUPAC name is (2E,4E,6Z)-7-[3-tert-butyl-2-(2,2-difluoroethoxy)-5-propan-2-ylphenyl]-3-methylocta-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6Z)-7-[3-tert-butyl-2-(2,2-difluoroethoxy)-5-propan-2-ylphenyl]-3-methylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 59076822 |
| Molecular Formula | C24H32F2O3 |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | (2E,4E,6Z)-7-[3-tert-butyl-2-(2,2-difluoroethoxy)-5-propan-2-ylphenyl]-3-methylocta-2,4,6-trienoic acid |
| SMILES | C/C(=C/C=C/C(C)=C/C(=O)O)c1cc(C(C)C)cc(C(C)(C)C)c1OCC(F)F |
| InChI | InChI=1S/C24H32F2O3/c1-15(2)18-12-19(17(4)10-8-9-16(3)11-22(27)28)23(29-14-21(25)26)20(13-18)24(5,6)7/h8-13,15,21H,14H2,1-7H3,(H,27,28)/b9-8+,16-11+,17-10- |
| InChIKey | UDZORQKBUUAXRS-HNBVHFCESA-N |
| XLogP | 6.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|