C17H24O3 — CID 83959280
(E)-3-(3-tert-butyl-2-ethoxy-5-methylphenyl)but-2-enoic acid (PubChem CID 83959280) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (E)-3-(3-tert-butyl-2-ethoxy-5-methylphenyl)but-2-enoic acid.
| Compound Name | (E)-3-(3-tert-butyl-2-ethoxy-5-methylphenyl)but-2-enoic acid |
|---|---|
| PubChem CID | 83959280 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (E)-3-(3-tert-butyl-2-ethoxy-5-methylphenyl)but-2-enoic acid |
| SMILES | CCOc1c(/C(C)=C/C(=O)O)cc(C)cc1C(C)(C)C |
| InChI | InChI=1S/C17H24O3/c1-7-20-16-13(12(3)10-15(18)19)8-11(2)9-14(16)17(4,5)6/h8-10H,7H2,1-6H3,(H,18,19)/b12-10+ |
| InChIKey | JTABQGAQIXZASN-ZRDIBKRKSA-N |
| XLogP | 4.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|