C25H36O3 — CID 85074545
7-(2-butoxy-3-tert-butyl-5-ethylphenyl)-3-methylocta-2,4,6-trienoic acid (PubChem CID 85074545) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is 7-(2-butoxy-3-tert-butyl-5-ethylphenyl)-3-methylocta-2,4,6-trienoic acid.
| Compound Name | 7-(2-butoxy-3-tert-butyl-5-ethylphenyl)-3-methylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 85074545 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 7-(2-butoxy-3-tert-butyl-5-ethylphenyl)-3-methylocta-2,4,6-trienoic acid |
| SMILES | CCCCOc1c(C(C)=CC=CC(C)=CC(=O)O)cc(CC)cc1C(C)(C)C |
| InChI | InChI=1S/C25H36O3/c1-8-10-14-28-24-21(16-20(9-2)17-22(24)25(5,6)7)19(4)13-11-12-18(3)15-23(26)27/h11-13,15-17H,8-10,14H2,1-7H3,(H,26,27) |
| InChIKey | PISOSSPAUPPJKS-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|