C16H23BrO3 — CID 20984887
4-(2-bromo-6-tert-butyl-4-ethylphenoxy)butanoic acid (PubChem CID 20984887) has the molecular formula C16H23BrO3 and a molecular weight of 343.26 g/mol. Its IUPAC name is 4-(2-bromo-6-tert-butyl-4-ethylphenoxy)butanoic acid.
| Compound Name | 4-(2-bromo-6-tert-butyl-4-ethylphenoxy)butanoic acid |
|---|---|
| PubChem CID | 20984887 |
| Molecular Formula | C16H23BrO3 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 4-(2-bromo-6-tert-butyl-4-ethylphenoxy)butanoic acid |
| SMILES | CCc1cc(Br)c(OCCCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H23BrO3/c1-5-11-9-12(16(2,3)4)15(13(17)10-11)20-8-6-7-14(18)19/h9-10H,5-8H2,1-4H3,(H,18,19) |
| InChIKey | HFDFUDLMBXFYHJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|