C16H30O8P2 — CID 174565442
(2,6-ditert-butyl-4-ethylphenyl) dihydrogen phosphate;phosphoric acid (PubChem CID 174565442) has the molecular formula C16H30O8P2 and a molecular weight of 412.36 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-ethylphenyl) dihydrogen phosphate;phosphoric acid.
| Compound Name | (2,6-ditert-butyl-4-ethylphenyl) dihydrogen phosphate;phosphoric acid |
|---|---|
| PubChem CID | 174565442 |
| Molecular Formula | C16H30O8P2 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | (2,6-ditert-butyl-4-ethylphenyl) dihydrogen phosphate;phosphoric acid |
| SMILES | CCc1cc(C(C)(C)C)c(OP(=O)(O)O)c(C(C)(C)C)c1.O=P(O)(O)O |
| InChI | InChI=1S/C16H27O4P.H3O4P/c1-8-11-9-12(15(2,3)4)14(20-21(17,18)19)13(10-11)16(5,6)7;1-5(2,3)4/h9-10H,8H2,1-7H3,(H2,17,18,19);(H3,1,2,3,4) |
| InChIKey | JJYDQLFDTJWWBD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|