C19H33O4P — CID 56619039
(4-butoxy-3,5-ditert-butylphenyl)methylphosphonic acid (PubChem CID 56619039) has the molecular formula C19H33O4P and a molecular weight of 356.44 g/mol. Its IUPAC name is (4-butoxy-3,5-ditert-butylphenyl)methylphosphonic acid.
| Compound Name | (4-butoxy-3,5-ditert-butylphenyl)methylphosphonic acid |
|---|---|
| PubChem CID | 56619039 |
| Molecular Formula | C19H33O4P |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (4-butoxy-3,5-ditert-butylphenyl)methylphosphonic acid |
| SMILES | CCCCOc1c(C(C)(C)C)cc(CP(=O)(O)O)cc1C(C)(C)C |
| InChI | InChI=1S/C19H33O4P/c1-8-9-10-23-17-15(18(2,3)4)11-14(13-24(20,21)22)12-16(17)19(5,6)7/h11-12H,8-10,13H2,1-7H3,(H2,20,21,22) |
| InChIKey | ZFIJDOXHGQQUPJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|