C19H32O2 — CID 59123457
4-butoxy-2,5-ditert-butyl-3-methylphenol (PubChem CID 59123457) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 4-butoxy-2,5-ditert-butyl-3-methylphenol.
| Compound Name | 4-butoxy-2,5-ditert-butyl-3-methylphenol |
|---|---|
| PubChem CID | 59123457 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 4-butoxy-2,5-ditert-butyl-3-methylphenol |
| SMILES | CCCCOc1c(C(C)(C)C)cc(O)c(C(C)(C)C)c1C |
| InChI | InChI=1S/C19H32O2/c1-9-10-11-21-17-13(2)16(19(6,7)8)15(20)12-14(17)18(3,4)5/h12,20H,9-11H2,1-8H3 |
| InChIKey | KCKNQYSLGBQPPV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|