C28H48O4 — CID 11080836
[2,6-ditert-butyl-4-hydroxy-3-(1-hydroxy-2-pentylheptyl)phenyl] acetate (PubChem CID 11080836) has the molecular formula C28H48O4 and a molecular weight of 448.69 g/mol. Its IUPAC name is [2,6-ditert-butyl-4-hydroxy-3-(1-hydroxy-2-pentylheptyl)phenyl] acetate.
| Compound Name | [2,6-ditert-butyl-4-hydroxy-3-(1-hydroxy-2-pentylheptyl)phenyl] acetate |
|---|---|
| PubChem CID | 11080836 |
| Molecular Formula | C28H48O4 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | [2,6-ditert-butyl-4-hydroxy-3-(1-hydroxy-2-pentylheptyl)phenyl] acetate |
| SMILES | CCCCCC(CCCCC)C(O)c1c(O)cc(C(C)(C)C)c(OC(C)=O)c1C(C)(C)C |
| InChI | InChI=1S/C28H48O4/c1-10-12-14-16-20(17-15-13-11-2)25(31)23-22(30)18-21(27(4,5)6)26(32-19(3)29)24(23)28(7,8)9/h18,20,25,30-31H,10-17H2,1-9H3 |
| InChIKey | OCTPAXIWFQNGCA-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|