C25H38O3 — CID 11784010
[2,6-ditert-butyl-3-(cyclooctylidenemethyl)-4-hydroxyphenyl] acetate (PubChem CID 11784010) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is [2,6-ditert-butyl-3-(cyclooctylidenemethyl)-4-hydroxyphenyl] acetate.
| Compound Name | [2,6-ditert-butyl-3-(cyclooctylidenemethyl)-4-hydroxyphenyl] acetate |
|---|---|
| PubChem CID | 11784010 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | [2,6-ditert-butyl-3-(cyclooctylidenemethyl)-4-hydroxyphenyl] acetate |
| SMILES | CC(=O)Oc1c(C(C)(C)C)cc(O)c(C=C2CCCCCCC2)c1C(C)(C)C |
| InChI | InChI=1S/C25H38O3/c1-17(26)28-23-20(24(2,3)4)16-21(27)19(22(23)25(5,6)7)15-18-13-11-9-8-10-12-14-18/h15-16,27H,8-14H2,1-7H3 |
| InChIKey | GKWRLKGYECXIIS-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|