C17H27NO3 — CID 10880904
[3-(aminomethyl)-2,6-ditert-butyl-4-hydroxyphenyl] acetate (PubChem CID 10880904) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is [3-(aminomethyl)-2,6-ditert-butyl-4-hydroxyphenyl] acetate.
| Compound Name | [3-(aminomethyl)-2,6-ditert-butyl-4-hydroxyphenyl] acetate |
|---|---|
| PubChem CID | 10880904 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | [3-(aminomethyl)-2,6-ditert-butyl-4-hydroxyphenyl] acetate |
| SMILES | CC(=O)Oc1c(C(C)(C)C)cc(O)c(CN)c1C(C)(C)C |
| InChI | InChI=1S/C17H27NO3/c1-10(19)21-15-12(16(2,3)4)8-13(20)11(9-18)14(15)17(5,6)7/h8,20H,9,18H2,1-7H3 |
| InChIKey | DJFANDMJDMYQFC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|