C35H52O5 — CID 88812959
3,5-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxybenzoyl)oxy-2-(2,2-dimethylpropyl)benzoic acid (PubChem CID 88812959) has the molecular formula C35H52O5 and a molecular weight of 552.80 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxybenzoyl)oxy-2-(2,2-dimethylpropyl)benzoic acid.
| Compound Name | 3,5-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxybenzoyl)oxy-2-(2,2-dimethylpropyl)benzoic acid |
|---|---|
| PubChem CID | 88812959 |
| Molecular Formula | C35H52O5 |
| Molecular Weight | 552.80 g/mol |
| Exact Mass | 552.38 |
| IUPAC Name | 3,5-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxybenzoyl)oxy-2-(2,2-dimethylpropyl)benzoic acid |
| SMILES | CC(C)(C)Cc1c(C(=O)O)cc(C(C)(C)C)c(OC(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c1C(C)(C)C |
| InChI | InChI=1S/C35H52O5/c1-31(2,3)19-22-21(29(37)38)18-25(34(10,11)12)28(26(22)35(13,14)15)40-30(39)20-16-23(32(4,5)6)27(36)24(17-20)33(7,8)9/h16-18,36H,19H2,1-15H3,(H,37,38) |
| InChIKey | FZUDFCAWRKPAOK-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.80 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|