C30H42O5 — CID 175546183
3,5-ditert-butyl-2-(3,5-ditert-butyl-2-hydroxybenzoyl)oxybenzoic acid (PubChem CID 175546183) has the molecular formula C30H42O5 and a molecular weight of 482.66 g/mol. Its IUPAC name is 3,5-ditert-butyl-2-(3,5-ditert-butyl-2-hydroxybenzoyl)oxybenzoic acid.
| Compound Name | 3,5-ditert-butyl-2-(3,5-ditert-butyl-2-hydroxybenzoyl)oxybenzoic acid |
|---|---|
| PubChem CID | 175546183 |
| Molecular Formula | C30H42O5 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | 3,5-ditert-butyl-2-(3,5-ditert-butyl-2-hydroxybenzoyl)oxybenzoic acid |
| SMILES | CC(C)(C)c1cc(C(=O)Oc2c(C(=O)O)cc(C(C)(C)C)cc2C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H42O5/c1-27(2,3)17-13-19(23(31)21(15-17)29(7,8)9)26(34)35-24-20(25(32)33)14-18(28(4,5)6)16-22(24)30(10,11)12/h13-16,31H,1-12H3,(H,32,33) |
| InChIKey | PEIZCBQBVHIERH-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|