C14H20O5Si — CID 173284211
5-tert-butyl-2-dimethylsilyloxybenzene-1,3-dicarboxylic acid (PubChem CID 173284211) has the molecular formula C14H20O5Si and a molecular weight of 296.40 g/mol. Its IUPAC name is 5-tert-butyl-2-dimethylsilyloxybenzene-1,3-dicarboxylic acid.
| Compound Name | 5-tert-butyl-2-dimethylsilyloxybenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 173284211 |
| Molecular Formula | C14H20O5Si |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 5-tert-butyl-2-dimethylsilyloxybenzene-1,3-dicarboxylic acid |
| SMILES | C[SiH](C)Oc1c(C(=O)O)cc(C(C)(C)C)cc1C(=O)O |
| InChI | InChI=1S/C14H20O5Si/c1-14(2,3)8-6-9(12(15)16)11(19-20(4)5)10(7-8)13(17)18/h6-7,20H,1-5H3,(H,15,16)(H,17,18) |
| InChIKey | UPNLYUIPOFTDBA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|