C30H42CrO6 — CID 54696006
chromium(2+);bis(2,4-ditert-butyl-6-carboxyphenolate) (PubChem CID 54696006) has the molecular formula C30H42CrO6 and a molecular weight of 550.66 g/mol. Its IUPAC name is chromium(2+);bis(2,4-ditert-butyl-6-carboxyphenolate).
| Compound Name | chromium(2+);bis(2,4-ditert-butyl-6-carboxyphenolate) |
|---|---|
| PubChem CID | 54696006 |
| Molecular Formula | C30H42CrO6 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | chromium(2+);bis(2,4-ditert-butyl-6-carboxyphenolate) |
| SMILES | CC(C)(C)c1cc(C(=O)O)c([O-])c(C(C)(C)C)c1.CC(C)(C)c1cc(C(=O)O)c([O-])c(C(C)(C)C)c1.[Cr+2] |
| InChI | InChI=1S/2C15H22O3.Cr/c2*1-14(2,3)9-7-10(13(17)18)12(16)11(8-9)15(4,5)6;/h2*7-8,16H,1-6H3,(H,17,18);/q;;+2/p-2 |
| InChIKey | HYDOOLWWEONQBG-UHFFFAOYSA-L |
| XLogP | 6.10 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |