C48H46O5 — CID 56614742
2-[2-hydroxy-3,5-bis(1-phenylethyl)benzoyl]oxy-3,5-bis(2-phenylpropan-2-yl)benzoic acid (PubChem CID 56614742) has the molecular formula C48H46O5 and a molecular weight of 702.89 g/mol. Its IUPAC name is 2-[2-hydroxy-3,5-bis(1-phenylethyl)benzoyl]oxy-3,5-bis(2-phenylpropan-2-yl)benzoic acid.
| Compound Name | 2-[2-hydroxy-3,5-bis(1-phenylethyl)benzoyl]oxy-3,5-bis(2-phenylpropan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 56614742 |
| Molecular Formula | C48H46O5 |
| Molecular Weight | 702.89 g/mol |
| Exact Mass | 702.33 |
| IUPAC Name | 2-[2-hydroxy-3,5-bis(1-phenylethyl)benzoyl]oxy-3,5-bis(2-phenylpropan-2-yl)benzoic acid |
| SMILES | CC(c1ccccc1)c1cc(C(=O)Oc2c(C(=O)O)cc(C(C)(C)c3ccccc3)cc2C(C)(C)c2ccccc2)c(O)c(C(C)c2ccccc2)c1 |
| InChI | InChI=1S/C48H46O5/c1-31(33-19-11-7-12-20-33)35-27-39(32(2)34-21-13-8-14-22-34)43(49)40(28-35)46(52)53-44-41(45(50)51)29-38(47(3,4)36-23-15-9-16-24-36)30-42(44)48(5,6)37-25-17-10-18-26-37/h7-32,49H,1-6H3,(H,50,51) |
| InChIKey | OWPKLBWTYONJDK-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.89 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|