C31H30O3 — CID 15085359
3-(1,3-diphenylbutyl)-2-hydroxy-5-(1-phenylethyl)benzoic acid (PubChem CID 15085359) has the molecular formula C31H30O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is 3-(1,3-diphenylbutyl)-2-hydroxy-5-(1-phenylethyl)benzoic acid.
| Compound Name | 3-(1,3-diphenylbutyl)-2-hydroxy-5-(1-phenylethyl)benzoic acid |
|---|---|
| PubChem CID | 15085359 |
| Molecular Formula | C31H30O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 3-(1,3-diphenylbutyl)-2-hydroxy-5-(1-phenylethyl)benzoic acid |
| SMILES | CC(CC(c1ccccc1)c1cc(C(C)c2ccccc2)cc(C(=O)O)c1O)c1ccccc1 |
| InChI | InChI=1S/C31H30O3/c1-21(23-12-6-3-7-13-23)18-27(25-16-10-5-11-17-25)28-19-26(20-29(30(28)32)31(33)34)22(2)24-14-8-4-9-15-24/h3-17,19-22,27,32H,18H2,1-2H3,(H,33,34) |
| InChIKey | BHOVDSKBRLNEDP-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |