C17H29NO2 — CID 71488404
2-(3-aminopropyl)-3,5-ditert-butylbenzene-1,4-diol (PubChem CID 71488404) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 2-(3-aminopropyl)-3,5-ditert-butylbenzene-1,4-diol.
| Compound Name | 2-(3-aminopropyl)-3,5-ditert-butylbenzene-1,4-diol |
|---|---|
| PubChem CID | 71488404 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 2-(3-aminopropyl)-3,5-ditert-butylbenzene-1,4-diol |
| SMILES | CC(C)(C)c1cc(O)c(CCCN)c(C(C)(C)C)c1O |
| InChI | InChI=1S/C17H29NO2/c1-16(2,3)12-10-13(19)11(8-7-9-18)14(15(12)20)17(4,5)6/h10,19-20H,7-9,18H2,1-6H3 |
| InChIKey | UGOOICJAHSNALU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|