C14H23NO2 — CID 86244244
3-amino-2,5-ditert-butylbenzene-1,4-diol (PubChem CID 86244244) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 3-amino-2,5-ditert-butylbenzene-1,4-diol.
| Compound Name | 3-amino-2,5-ditert-butylbenzene-1,4-diol |
|---|---|
| PubChem CID | 86244244 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 3-amino-2,5-ditert-butylbenzene-1,4-diol |
| SMILES | CC(C)(C)c1cc(O)c(C(C)(C)C)c(N)c1O |
| InChI | InChI=1S/C14H23NO2/c1-13(2,3)8-7-9(16)10(14(4,5)6)11(15)12(8)17/h7,16-17H,15H2,1-6H3 |
| InChIKey | JTAGGNFCOGELMU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|